Products 7477-09-0

CAS 7477-09-0 is the registry number for 6-Bromo-5-nitropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-bromo-5-nitropyridine-3-carboxylic acid (CAS 7477-09-0) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 6-bromo-5-nitropyridine-3-carboxylic acid. InChIKey: VXLXYUKVRAJUMP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrN2O4
Molecular weight247.00 g/mol
IUPAC name6-bromo-5-nitropyridine-3-carboxylic acid
InChIKeyVXLXYUKVRAJUMP-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1[N+](=O)[O-])Br)C(=O)O

Computed by PubChem (NCBI)