Products 749160-35-8
CAS 749160-35-8 is the registry number for erythro-4-Hydroxy Ritalinic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-(4-hydroxyphenyl)-2-[(2R)-piperidin-2-yl]ethaneperoxoic acid (CAS 749160-35-8) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-2-[(2R)-piperidin-2-yl]ethaneperoxoic acid. InChIKey: XRRKSPUBNIRWRT-NEPJUHHUSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-2-[(2R)-piperidin-2-yl]ethaneperoxoic acid |
| InChIKey | XRRKSPUBNIRWRT-NEPJUHHUSA-N |
| SMILES | C1CCN[C@H](C1)[C@H](C2=CC=C(C=C2)O)C(=O)OO |
Computed by PubChem (NCBI)
Synonyms:
erythro-4-Hydroxy Ritalinic Acid