CAS 749906-83-0 appears in our catalog under these names: 2-Chloro-4-methyl-8-(propan-2-yl)quinoline, 95%, 2-Chloro-4-methyl-8-(propan-2-yl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-chloro-4-methyl-8-propan-2-ylquinoline (CAS 749906-83-0) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 2-chloro-4-methyl-8-propan-2-ylquinoline. InChIKey: IQCLKXIOPHJAIT-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 2-chloro-4-methyl-8-propan-2-ylquinoline |
| InChIKey | IQCLKXIOPHJAIT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC=C2C(C)C)Cl |
Computed by PubChem (NCBI)