Products 74998-19-9
CAS 74998-19-9 appears in our catalog under these names: Methyl 3-(2-oxopropyl)benzoate, 95%, Methyl 3–(2–oxopropyl)benzoate, 3-Methoxycarbonylphenylacetone, Methyl 3-(2-oxopropyl)benzoate, 98%, 98%, Methyl 3-(2-oxopropyl)benzoate, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg.
Methyl 3-(2-oxopropyl)benzoate (CAS 74998-19-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 3-(2-oxopropyl)benzoate. InChIKey: FRHNAXWWCGBMIE-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl 3-(2-oxopropyl)benzoate |
| InChIKey | FRHNAXWWCGBMIE-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)