CAS 75294-49-4 appears in our catalog under these names: tert-Butyl 4-amino-2-chlorobenzoate, 98%, Tert-butyl 4-amino-2-chlorobenzoate, 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 5g.
Tert-butyl 4-amino-2-chlorobenzoate (CAS 75294-49-4) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: tert-butyl 4-amino-2-chlorobenzoate. InChIKey: LLOXEUOQRNPJJK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | tert-butyl 4-amino-2-chlorobenzoate |
| InChIKey | LLOXEUOQRNPJJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)