CAS 75433-99-7 appears in our catalog under these names: 6-Methoxyquinoline-2-carboxylic acid, 95%, 6–Methoxyquinoline–2–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg, 25g.
6-methoxyquinoline-2-carboxylic acid (CAS 75433-99-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 6-methoxyquinoline-2-carboxylic acid. InChIKey: YXPYIZUQEDQMPS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 6-methoxyquinoline-2-carboxylic acid |
| InChIKey | YXPYIZUQEDQMPS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)