Products 75434-18-3
CAS 75434-18-3 appears in our catalog under these names: 6-Hydroxyquinoline-2-carboxylic acid, 98%, 6-hydroxyquinoline-2-carboxylic acid, 6–Hydroxyquinoline–2–carboxylic acid, 6-Hydroxyquinoline-2-carboxylic acid 98%, 6-Hydroxy-2-quinolinecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10mg, 50mg, 2,5g, 25g.
6-hydroxyquinoline-2-carboxylic acid (CAS 75434-18-3) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 6-hydroxyquinoline-2-carboxylic acid. InChIKey: KVQARDYXZJGMFU-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-hydroxyquinoline-2-carboxylic acid |
| InChIKey | KVQARDYXZJGMFU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)C(=O)O)C=C1O |
Computed by PubChem (NCBI)