CAS 75487-82-0 appears in our catalog under these names: 6-Fluorocoumarin, 95-<97%, 6-Fluorocoumarin, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
6-fluorochromen-2-one (CAS 75487-82-0) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 6-fluorochromen-2-one. InChIKey: WBUWUULCBSNTNA-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 6-fluorochromen-2-one |
| InChIKey | WBUWUULCBSNTNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1F |
Computed by PubChem (NCBI)