CAS 7549-44-2 appears in our catalog under these names: methyl (2E)-3-{4-[(1E)-3-methoxy-3-oxoprop-1-en-1-yl]phenyl}prop-2-enoate, 95%, Dimethyl 1,4–Phenylenediacrylate, Dimethyl 1,4-Phenylenediacrylate, >95.0%(GC), methyl (2E)-3-{4-[(1E)-3-methoxy-3-oxoprop-1-en-1-yl]phenyl}prop-2-enoate, 95.0%, 95.0%, dimethyl (2E,2'E)-3,3'-(1,4-phenylene)bisacrylate, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 500mg, 1g, 5g.
Methyl (E)-3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate (CAS 7549-44-2) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: methyl (E)-3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate. InChIKey: IFNSXAJHSAPYLB-FIFLTTCUSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | methyl (E)-3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate |
| InChIKey | IFNSXAJHSAPYLB-FIFLTTCUSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)/C=C/C(=O)OC |
Computed by PubChem (NCBI)