Products 755036-50-1
CAS 755036-50-1 is the registry number for Dichotomine D. Offered by: MedChemExpress. Available pack sizes: Get quote.
Butyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate (CAS 755036-50-1) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: butyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: LSUSTOFGGHZNSS-HNNXBMFYSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | butyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | LSUSTOFGGHZNSS-HNNXBMFYSA-N |
| SMILES | CCCCOC(=O)C1=NC(=C2C(=C1)C3=CC=CC=C3N2)[C@H](CO)O |
Computed by PubChem (NCBI)