CAS 75633-69-1 is the registry number for 3-amino-5-nitrobenzamide. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-5-nitrobenzamide (CAS 75633-69-1) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-amino-5-nitrobenzamide. InChIKey: CPRGSOYWINBLDR-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-amino-5-nitrobenzamide |
| InChIKey | CPRGSOYWINBLDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)