Products 75636-88-3
CAS 75636-88-3 appears in our catalog under these names: 2，5–Diamino–1，4–benzenedicarbonitrile, 2,5-Diaminoterephthalonitrile 97%, 2,5-Diaminoterephthalonitrile, 97%, 97%, 2,5-Diaminoterephthalonitrile, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 500mg, 250mg, 1g.
2,5-diaminobenzene-1,4-dicarbonitrile (CAS 75636-88-3) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 2,5-diaminobenzene-1,4-dicarbonitrile. InChIKey: DJVJDQRJKTVAEU-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 2,5-diaminobenzene-1,4-dicarbonitrile |
| InChIKey | DJVJDQRJKTVAEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)C#N)N)C#N |
Computed by PubChem (NCBI)