Products 7574-86-9

CAS 7574-86-9 is the registry number for Dopexamine Impurity 14. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

6-[2-(3,4-dimethoxyphenyl)ethylamino]-6-oxohexanoic acid (CAS 7574-86-9) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: 6-[2-(3,4-dimethoxyphenyl)ethylamino]-6-oxohexanoic acid. InChIKey: QTBANYVVJXZPQF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO5
Molecular weight309.36 g/mol
IUPAC name6-[2-(3,4-dimethoxyphenyl)ethylamino]-6-oxohexanoic acid
InChIKeyQTBANYVVJXZPQF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CCNC(=O)CCCCC(=O)O)OC

Computed by PubChem (NCBI)