Products 7579-36-4
CAS 7579-36-4 appears in our catalog under these names: Dibenzyl oxalate, Dibenzyl Oxalate, >98.0%(GC)(qNMR), Dibenzyl oxalate 98%, DIBENZYL OXALATE, 98%, Dibenzyl oxalate, 98%, 98%. Offered by: Biosynth, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 5g, 25g, 500g, 1000g, 1g, 10g, 50g.
Dibenzyl oxalate (CAS 7579-36-4) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: dibenzyl oxalate. InChIKey: ZYZXGWGQYNTGAU-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | dibenzyl oxalate |
| InChIKey | ZYZXGWGQYNTGAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)