CAS 75853-08-6 is the registry number for 1-(Pentafluorophenyl)ethanol ,, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 1g.
1-(2,3,4,5,6-pentafluorophenyl)ethanol (CAS 75853-08-6) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: 1-(2,3,4,5,6-pentafluorophenyl)ethanol. InChIKey: WYUNHWKTLDBPLE-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentafluorophenyl)ethanol |
| InChIKey | WYUNHWKTLDBPLE-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=C(C(=C1F)F)F)F)F)O |
Computed by PubChem (NCBI)