Products 1803570-73-1
CAS 1803570-73-1 appears in our catalog under these names: [2,6-Difluoro-4-(trifluoromethyl)phenyl]methanol, 95%, 2,6-Difluoro-4-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g.
[2,6-difluoro-4-(trifluoromethyl)phenyl]methanol (CAS 1803570-73-1) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: [2,6-difluoro-4-(trifluoromethyl)phenyl]methanol. InChIKey: IWZJMMRHZHBIBS-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | [2,6-difluoro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | IWZJMMRHZHBIBS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CO)F)C(F)(F)F |
Computed by PubChem (NCBI)