Products 1935291-66-9
CAS 1935291-66-9 is the registry number for 2,4-Difluoro-5-methoxybenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1,5-difluoro-2-methoxy-4-(trifluoromethyl)benzene (CAS 1935291-66-9) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: 1,5-difluoro-2-methoxy-4-(trifluoromethyl)benzene. InChIKey: MLOXCTCZEPSAAM-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 1,5-difluoro-2-methoxy-4-(trifluoromethyl)benzene |
| InChIKey | MLOXCTCZEPSAAM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(F)(F)F)F)F |
Computed by PubChem (NCBI)