CAS 238403-50-4 appears in our catalog under these names: 2,3-Difluoro-4-(trifluoromethyl)benzyl alcohol, 98%, (2,3-Difluoro-4-(trifluoromethyl)phenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
[2,3-difluoro-4-(trifluoromethyl)phenyl]methanol (CAS 238403-50-4) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: [2,3-difluoro-4-(trifluoromethyl)phenyl]methanol. InChIKey: YDHLVDCBIBCSPA-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | [2,3-difluoro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | YDHLVDCBIBCSPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CO)F)F)C(F)(F)F |
Computed by PubChem (NCBI)