Products 1800231-22-4
CAS 1800231-22-4 is the registry number for 2,6-Difluoro-3-(trifluoromethyl)benzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2,6-difluoro-3-(trifluoromethyl)phenyl]methanol (CAS 1800231-22-4) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: [2,6-difluoro-3-(trifluoromethyl)phenyl]methanol. InChIKey: QYFGOUMLWRFLDI-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | [2,6-difluoro-3-(trifluoromethyl)phenyl]methanol |
| InChIKey | QYFGOUMLWRFLDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)CO)F |
Computed by PubChem (NCBI)