Products 76-50-6
CAS 76-50-6 is the registry number for Bornyval. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-methylbutanoate (CAS 76-50-6) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-methylbutanoate. InChIKey: MPYYVGIJHREDBO-YWPYICTPSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-methylbutanoate |
| InChIKey | MPYYVGIJHREDBO-YWPYICTPSA-N |
| SMILES | CC(C)CC(=O)O[C@@H]1C[C@@H]2CC[C@]1(C2(C)C)C |
Computed by PubChem (NCBI)