CAS 760179-81-5 is the registry number for 3-Chloro-6-nitroisoquinoline 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-chloro-6-nitroisoquinoline (CAS 760179-81-5) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 3-chloro-6-nitroisoquinoline. InChIKey: PFBVXFDZOZBWJU-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 3-chloro-6-nitroisoquinoline |
| InChIKey | PFBVXFDZOZBWJU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(C=C2C=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)