Products 760190-65-6
CAS 760190-65-6 is the registry number for 3-Benzylidene-2-hydroxyisoindolin-1-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(3Z)-3-benzylidene-2-hydroxyisoindol-1-one (CAS 760190-65-6) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: (3Z)-3-benzylidene-2-hydroxyisoindol-1-one. InChIKey: STCQXZYMOKJWBP-UVTDQMKNSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3Z)-3-benzylidene-2-hydroxyisoindol-1-one |
| InChIKey | STCQXZYMOKJWBP-UVTDQMKNSA-N |
| SMILES | C1=CC=C(C=C1)/C=C\2/C3=CC=CC=C3C(=O)N2O |
Computed by PubChem (NCBI)