Products 762288-12-0
CAS 762288-12-0 is the registry number for Methyl 7-fluoro-2-methyl-1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 7-fluoro-2-methyl-1H-indole-3-carboxylate (CAS 762288-12-0) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: methyl 7-fluoro-2-methyl-1H-indole-3-carboxylate. InChIKey: ZTYFUWPFWCLAEN-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | methyl 7-fluoro-2-methyl-1H-indole-3-carboxylate |
| InChIKey | ZTYFUWPFWCLAEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC=C2)F)C(=O)OC |
Computed by PubChem (NCBI)