CAS 7627-10-3 is the registry number for 5-Hydrazinyl-3-phenyl-1,2,4-oxadiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(3-phenyl-1,2,4-oxadiazol-5-yl)hydrazine (CAS 7627-10-3) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: (3-phenyl-1,2,4-oxadiazol-5-yl)hydrazine. InChIKey: DZEMASDGXBAGRN-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | (3-phenyl-1,2,4-oxadiazol-5-yl)hydrazine |
| InChIKey | DZEMASDGXBAGRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)NN |
Computed by PubChem (NCBI)