CAS 76497-81-9 appears in our catalog under these names: Levamisole Impurity 9, (S)-6-(4-Nitrophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole, 98%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(6S)-6-(4-nitrophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CAS 76497-81-9) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: (6S)-6-(4-nitrophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole. InChIKey: LPIVDKLFFJWWBT-SNVBAGLBSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | (6S)-6-(4-nitrophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| InChIKey | LPIVDKLFFJWWBT-SNVBAGLBSA-N |
| SMILES | C1CSC2=N[C@H](CN21)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)