Products 76535-74-5
CAS 76535-74-5 appears in our catalog under these names: tert–Butyl piperazine–1–carboxylate hydrochloride, Boc-Paz*HCl, tert-Butyl piperazine-1-carboxylate hydrochloride 95%, tert-Butyl piperazine-1-carboxylate hydrochloride, 95%+, 95%+, Boc-piperazine hydrochloride, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 25g, 10g, 500g, 1000g, 1g, 1kg.
Tert-butyl piperazine-1-carboxylate;hydrochloride (CAS 76535-74-5) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl piperazine-1-carboxylate;hydrochloride. InChIKey: DEGRJODPOICGRU-UHFFFAOYSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl piperazine-1-carboxylate;hydrochloride |
| InChIKey | DEGRJODPOICGRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cl |
Computed by PubChem (NCBI)
Synonyms:
Tert-butyl Piperazine-1-carboxylate Hydrochloride, BOC-PIPERAZINE HYDROCHLORIDE, 1-boc-piperazine hydrochloride, tert-butyl piperazine-1-carboxylate;hydrochloride, piperazine-1-carboxylic acid tert-butyl ester hydrochloride, Boc-Piz HCl, BOC-PIZ, BOC-PAZ HCL, DEGRJODPOICGRU-UHFFFAOYSA-N, N-(t-Butyloxycarbonyl)piperazine hydrochloride