Products 76834-54-3
CAS 76834-54-3 is the registry number for 4-[(2-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(4Z)-4-[(2-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one (CAS 76834-54-3) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (4Z)-4-[(2-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one. InChIKey: JLMWAHKOLKQUBF-TWGQIWQCSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (4Z)-4-[(2-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| InChIKey | JLMWAHKOLKQUBF-TWGQIWQCSA-N |
| SMILES | CC1=N/C(=C\C2=CC=CC=C2O)/C(=O)O1 |
Computed by PubChem (NCBI)