Products 76843-23-7
CAS 76843-23-7 appears in our catalog under these names: Przewaquinone A, Przewaquinone A, Przewaquinone A, 98.72%, PRZEWAQUINONE A, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 1 mg, 10 mg, 5 mg.
1-(hydroxymethyl)-6,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione (CAS 76843-23-7) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 1-(hydroxymethyl)-6,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione. InChIKey: CEHVTERMWMYLCP-UHFFFAOYSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 1-(hydroxymethyl)-6,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| InChIKey | CEHVTERMWMYLCP-UHFFFAOYSA-N |
| SMILES | CC1(CCCC2=C1C=CC3=C2C(=O)C(=O)C4=C3OC=C4CO)C |
Computed by PubChem (NCBI)