Products 76918-64-4
CAS 76918-64-4 appears in our catalog under these names: Ethyl 4-amino-3-nitrobenzoate, Ethyl 4-amino-3-nitrobenzoate, 98%, Ethyl 4-amino-3-nitrobenzoate, 97%, Ethyl 4-amino-3-nitrobenzoate, 97%, 97%, Ethyl 4-amino-3-nitrobenzoate, min. 95 %, 5 g. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 25g, 10g, 50g, 1g, 5g, 100g, 100mg, 250mg.
Ethyl 4-amino-3-nitrobenzoate (CAS 76918-64-4) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: ethyl 4-amino-3-nitrobenzoate. InChIKey: HPCYANYWTUCLMH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | ethyl 4-amino-3-nitrobenzoate |
| InChIKey | HPCYANYWTUCLMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)