Products 77060-74-3
CAS 77060-74-3 appears in our catalog under these names: Methyl 1,4-dihydroxy-2-naphthoate, 99%, Methyl 1,4-dihydroxy-2-naphthoate, 98%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g.
Methyl 1,4-dihydroxynaphthalene-2-carboxylate (CAS 77060-74-3) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: methyl 1,4-dihydroxynaphthalene-2-carboxylate. InChIKey: CRMAPJSLKLVFBT-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | methyl 1,4-dihydroxynaphthalene-2-carboxylate |
| InChIKey | CRMAPJSLKLVFBT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2C(=C1)O)O |
Computed by PubChem (NCBI)
Synonyms:
Methyl 1,4-dihydroxy-2-naphthoate, methyl 1,4-dihydroxynaphthalene-2-carboxylate, Methyl1,4-dihydroxy-2-naphthoate, 2-Naphthalenecarboxylic acid, 1,4-dihydroxy-, methyl ester, 1,4-dihydroxy-2-Naphthalenecarboxylic acid methyl ester, Methyl 1,4-dih, Methyl 1,4-dihydroxy-2-naphthoate #, Methyl 1,4-dihydroxynapthalene-2-carboxylate