Products 77083-30-8
CAS 77083-30-8 is the registry number for 1-(3,5-Dimethylphenyl)propan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3,5-dimethylphenyl)propan-2-amine;hydrochloride (CAS 77083-30-8) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)propan-2-amine;hydrochloride. InChIKey: LOYGTLHOQYZFEE-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)propan-2-amine;hydrochloride |
| InChIKey | LOYGTLHOQYZFEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)CC(C)N)C.Cl |
Computed by PubChem (NCBI)