CAS 77297-44-0 appears in our catalog under these names: N4-(4-Chlorophenyl)-2-methylpyrimidine-4,6-diamine, 95%, N4-(4-Chlorophenyl)-2-methylpyrimidine-4,6-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-N-(4-chlorophenyl)-2-methylpyrimidine-4,6-diamine (CAS 77297-44-0) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: 4-N-(4-chlorophenyl)-2-methylpyrimidine-4,6-diamine. InChIKey: XYDGSFSSNMJTFZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-N-(4-chlorophenyl)-2-methylpyrimidine-4,6-diamine |
| InChIKey | XYDGSFSSNMJTFZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)