Products 773057-18-4
CAS 773057-18-4 is the registry number for 2-Methyl-4-oxo-3,4-dihydroquinazoline-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 500mg, 250mg, 1000mg.
2-methyl-4-oxo-3H-quinazoline-7-carboxylic acid (CAS 773057-18-4) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-methyl-4-oxo-3H-quinazoline-7-carboxylic acid. InChIKey: CMXWUPHHVFCADZ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-methyl-4-oxo-3H-quinazoline-7-carboxylic acid |
| InChIKey | CMXWUPHHVFCADZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)