CAS 773108-01-3 is the registry number for 4-Acetamido-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-acetamido-2-(trifluoromethyl)benzoic acid (CAS 773108-01-3) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 4-acetamido-2-(trifluoromethyl)benzoic acid. InChIKey: IIANXAQMSKSZJK-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 4-acetamido-2-(trifluoromethyl)benzoic acid |
| InChIKey | IIANXAQMSKSZJK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)