CAS 933673-27-9 appears in our catalog under these names: (4-(Trifluoromethoxy)phenyl)-2-nitropropene, 95%, 4'-Trifluoromethoxy-β-methyl-β-nitrostyrene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1-[(E)-2-nitroprop-1-enyl]-4-(trifluoromethoxy)benzene (CAS 933673-27-9) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 1-[(E)-2-nitroprop-1-enyl]-4-(trifluoromethoxy)benzene. InChIKey: RESNPBJBJXXQMZ-VOTSOKGWSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 1-[(E)-2-nitroprop-1-enyl]-4-(trifluoromethoxy)benzene |
| InChIKey | RESNPBJBJXXQMZ-VOTSOKGWSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)OC(F)(F)F)/[N+](=O)[O-] |
Computed by PubChem (NCBI)