Products 1393577-03-1
CAS 1393577-03-1 is the registry number for Methyl 4-acetyl-6-(trifluoromethyl)picolinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-acetyl-6-(trifluoromethyl)pyridine-2-carboxylate (CAS 1393577-03-1) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: methyl 4-acetyl-6-(trifluoromethyl)pyridine-2-carboxylate. InChIKey: QMRNYXPCCIXNIR-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | methyl 4-acetyl-6-(trifluoromethyl)pyridine-2-carboxylate |
| InChIKey | QMRNYXPCCIXNIR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NC(=C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)