CAS 630117-94-1 appears in our catalog under these names: 2-([2-(Trifluoromethyl)phenyl]formamido)acetic acid, 95%, 2-{(2-(Trifluoromethyl)phenyl)formamido}acetic acid, 95%, 2-{(2-(Trifluoromethyl)phenyl)formamido}acetic acid, 2-{[2-(Trifluoromethyl)phenyl]formamido}acetic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-[[2-(trifluoromethyl)benzoyl]amino]acetic acid (CAS 630117-94-1) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 2-[[2-(trifluoromethyl)benzoyl]amino]acetic acid. InChIKey: ICMKIQQGWGHTGR-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 2-[[2-(trifluoromethyl)benzoyl]amino]acetic acid |
| InChIKey | ICMKIQQGWGHTGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)