Products 827029-20-9
CAS 827029-20-9 appears in our catalog under these names: Leflunomide Impurity 2, 3-Oxo-3-(4-(trifluoromethyl)anilino)propanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-oxo-3-[4-(trifluoromethyl)anilino]propanoic acid (CAS 827029-20-9) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 3-oxo-3-[4-(trifluoromethyl)anilino]propanoic acid. InChIKey: YYZDPRSUYSKOLW-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 3-oxo-3-[4-(trifluoromethyl)anilino]propanoic acid |
| InChIKey | YYZDPRSUYSKOLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)CC(=O)O |
Computed by PubChem (NCBI)