CAS 155894-96-5 is the registry number for 2-(2,2,2-Trifluoro-N-phenylacetamido)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CAS 155894-96-5) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid. InChIKey: AFPBGEGBLXHXNY-ZETCQYMHSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| InChIKey | AFPBGEGBLXHXNY-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)