CAS 77333-47-2 is the registry number for 4–CHLORO–3–METHOXY–5–NITROBENZONITRILE. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-chloro-3-methoxy-5-nitrobenzonitrile (CAS 77333-47-2) is a chemical compound with the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. IUPAC name: 4-chloro-3-methoxy-5-nitrobenzonitrile. InChIKey: XVGZCVPVFZZTDZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O3 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 4-chloro-3-methoxy-5-nitrobenzonitrile |
| InChIKey | XVGZCVPVFZZTDZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Cl)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)