CAS 7734-92-1 appears in our catalog under these names: 5-Methylmellein, 1H–2–Benzopyran–1–one, 3,4–dihydro–8–hydroxy–3,5–dimethyl–, (R)–, (R)-8-Hydroxy-3,5-dimethylisochroman-1-one, 98%, 98%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 1mg, 5mg, 25mg, 50 mg, 5 mg.
(3R)-8-hydroxy-3,5-dimethyl-3,4-dihydroisochromen-1-one (CAS 7734-92-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (3R)-8-hydroxy-3,5-dimethyl-3,4-dihydroisochromen-1-one. InChIKey: YETSBBYQOFXYGV-SSDOTTSWSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (3R)-8-hydroxy-3,5-dimethyl-3,4-dihydroisochromen-1-one |
| InChIKey | YETSBBYQOFXYGV-SSDOTTSWSA-N |
| SMILES | C[C@@H]1CC2=C(C=CC(=C2C(=O)O1)O)C |
Computed by PubChem (NCBI)