Products 773852-25-8
CAS 773852-25-8 is the registry number for 103D5R. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[1-(5-methoxy-2,2-dimethylchromen-6-yl)ethyl]imidazo[4,5-b]pyridine (CAS 773852-25-8) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: 1-[1-(5-methoxy-2,2-dimethylchromen-6-yl)ethyl]imidazo[4,5-b]pyridine. InChIKey: MCVWPJZBARCDLJ-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 1-[1-(5-methoxy-2,2-dimethylchromen-6-yl)ethyl]imidazo[4,5-b]pyridine |
| InChIKey | MCVWPJZBARCDLJ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C2=C(C=C1)OC(C=C2)(C)C)OC)N3C=NC4=C3C=CC=N4 |
Computed by PubChem (NCBI)