Products 773873-02-2

CAS 773873-02-2 is the registry number for 1-(4-Iodophenyl)-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(4-iodophenyl)pyrrole-2-carboxylic acid (CAS 773873-02-2) is a chemical compound with the molecular formula C11H8INO2 and a molecular weight of 313.09 g/mol. IUPAC name: 1-(4-iodophenyl)pyrrole-2-carboxylic acid. InChIKey: GQUUONHTDLGCQW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8INO2
Molecular weight313.09 g/mol
IUPAC name1-(4-iodophenyl)pyrrole-2-carboxylic acid
InChIKeyGQUUONHTDLGCQW-UHFFFAOYSA-N
SMILESC1=CN(C(=C1)C(=O)O)C2=CC=C(C=C2)I

Computed by PubChem (NCBI)