CAS 774530-27-7 is the registry number for (2-Amino-4-(methoxycarbonyl)phenyl)boronic acid, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2-amino-4-methoxycarbonylphenyl)boronic acid (CAS 774530-27-7) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: (2-amino-4-methoxycarbonylphenyl)boronic acid. InChIKey: OLHRJDVIFHDPLZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | (2-amino-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | OLHRJDVIFHDPLZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O |
Computed by PubChem (NCBI)