Products 775274-06-1
CAS 775274-06-1 is the registry number for AZD 9684. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3R)-2-[(6-amino-3-pyridinyl)methyl]-3-sulfanylbutanoic acid (CAS 775274-06-1) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: (2S,3R)-2-[(6-amino-3-pyridinyl)methyl]-3-sulfanylbutanoic acid. InChIKey: GYIYAOUGKJSCCG-HTRCEHHLSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | (2S,3R)-2-[(6-amino-3-pyridinyl)methyl]-3-sulfanylbutanoic acid |
| InChIKey | GYIYAOUGKJSCCG-HTRCEHHLSA-N |
| SMILES | C[C@H]([C@@H](CC1=CN=C(C=C1)N)C(=O)O)S |
Computed by PubChem (NCBI)