CAS 77635-17-7 is the registry number for 8-Oxo-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid (CAS 77635-17-7) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid. InChIKey: PZRRKRMQHIZTGR-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid |
| InChIKey | PZRRKRMQHIZTGR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)