Products 77636-08-9
CAS 77636-08-9 appears in our catalog under these names: Toddanone, Toddanone, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
5,7-dimethoxy-6-(3-methyl-2-oxobutyl)chromen-2-one (CAS 77636-08-9) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 5,7-dimethoxy-6-(3-methyl-2-oxobutyl)chromen-2-one. InChIKey: UBBJEHXBMMIIEU-UHFFFAOYSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 5,7-dimethoxy-6-(3-methyl-2-oxobutyl)chromen-2-one |
| InChIKey | UBBJEHXBMMIIEU-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC1=C(C=C2C(=C1OC)C=CC(=O)O2)OC |
Computed by PubChem (NCBI)