Products 2820446-91-9
CAS 2820446-91-9 is the registry number for Dimethyl 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate (CAS 2820446-91-9) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: dimethyl 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate. InChIKey: DFHUOEYMTRFDAI-UHFFFAOYSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | dimethyl 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate |
| InChIKey | DFHUOEYMTRFDAI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C3(CC2(C3)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)