CAS 135111-35-2 appears in our catalog under these names: [(4-Oxo-3,4-dihydrospiro[chromene-2,1'-cyclohexan]-6-yl)oxy]acetic acid, 95%, ((4–oxo–3,4–dihydrospiro(chromene–2,1'–cyclohexan)–6–yl)oxy)acetic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-(4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl)oxyacetic acid (CAS 135111-35-2) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 2-(4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl)oxyacetic acid. InChIKey: DHVARIMZVITILK-UHFFFAOYSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 2-(4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl)oxyacetic acid |
| InChIKey | DHVARIMZVITILK-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)OCC(=O)O |
Computed by PubChem (NCBI)