CAS 1142223-02-6 is the registry number for 5-(Cyclopropyl(3-hydroxyphenyl)methyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g.
5-[cyclopropyl-(3-hydroxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 1142223-02-6) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 5-[cyclopropyl-(3-hydroxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: JRQLEKRVRVVAME-UHFFFAOYSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 5-[cyclopropyl-(3-hydroxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | JRQLEKRVRVVAME-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C(C2CC2)C3=CC(=CC=C3)O)C |
Computed by PubChem (NCBI)